Product Details
The benzene ring is attached to an allyl group, with the β-carbon of the allyl group bonded to a nitro group (–NO₂−NO2), creating a conjugated π-electron system. This imparts the chemical characteristics of both alkenes and nitro compounds. Typically, it appears as an oily liquid or crystalline solid ranging from yellow to orange, and has a strong odor. It is only slightly soluble in water but dissolves readily in organic solvents such as ethanol, ether, and acetone.
Chemical Properties
| Melting point | 63-65 °C (lit.) |
| Boiling point | 263.0±9.0 °C(Predicted) |
| density | 1.141±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetone, Chloroform, Dichloromethane, Methanol |
| form | Crystalline Powder |
| color | Yellow |
| InChI | InChI=1S/C9H9NO2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | WGSVFWFSJDAYBM-BQYQJAHWSA-N |
| SMILES | C1(C=C([N+]([O-])=O)C)=CC=CC=C1 |
| NIST Chemistry Reference | Benzene, (2-nitro-1-propenyl)-(705-60-2) |
| EPA Substance Registry System | (2-Nitro-1-propenyl)benzene (705-60-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | DA6495000 |
| HS Code | 29042090 |
